C21H13F5I2N2O4 — CID 126044736
ethyl 2-[2,4-diiodo-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126044736) has the molecular formula C21H13F5I2N2O4 and a molecular weight of 706.14 g/mol. Its IUPAC name is ethyl 2-[2,4-diiodo-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,4-diiodo-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126044736 |
| Molecular Formula | C21H13F5I2N2O4 |
| Molecular Weight | 706.14 g/mol |
| Exact Mass | 705.89 |
| IUPAC Name | ethyl 2-[2,4-diiodo-6-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(I)cc1/C=C1\C(=O)N(c2c(F)c(F)c(F)c(F)c2F)N=C1C |
| InChI | InChI=1S/C21H13F5I2N2O4/c1-3-33-13(31)7-34-20-9(4-10(27)6-12(20)28)5-11-8(2)29-30(21(11)32)19-17(25)15(23)14(22)16(24)18(19)26/h4-6H,3,7H2,1-2H3/b11-5- |
| InChIKey | VGCLUUGVOOIPNS-WZUFQYTHSA-N |
| XLogP | 5.34 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.14 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|