C21H14BrF5N2O4 — CID 126038173
ethyl 2-[4-bromo-2-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126038173) has the molecular formula C21H14BrF5N2O4 and a molecular weight of 533.25 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126038173 |
| Molecular Formula | C21H14BrF5N2O4 |
| Molecular Weight | 533.25 g/mol |
| Exact Mass | 532.01 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(Z)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Br)cc1/C=C1\C(=O)N(c2c(F)c(F)c(F)c(F)c2F)N=C1C |
| InChI | InChI=1S/C21H14BrF5N2O4/c1-3-32-14(30)8-33-13-5-4-11(22)6-10(13)7-12-9(2)28-29(21(12)31)20-18(26)16(24)15(23)17(25)19(20)27/h4-7H,3,8H2,1-2H3/b12-7- |
| InChIKey | KSFCCBAUZBFAAX-GHXNOFRVSA-N |
| XLogP | 4.89 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|