C20H16BrClN2O4 — CID 50886744
5-[(4Z)-4-[(5-bromo-2-ethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-chlorobenzoic acid (PubChem CID 50886744) has the molecular formula C20H16BrClN2O4 and a molecular weight of 463.72 g/mol. Its IUPAC name is 5-[(4Z)-4-[(5-bromo-2-ethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[(4Z)-4-[(5-bromo-2-ethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 50886744 |
| Molecular Formula | C20H16BrClN2O4 |
| Molecular Weight | 463.72 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 5-[(4Z)-4-[(5-bromo-2-ethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-chlorobenzoic acid |
| SMILES | CCOc1ccc(Br)cc1/C=C1\C(=O)N(c2ccc(Cl)c(C(=O)O)c2)N=C1C |
| InChI | InChI=1S/C20H16BrClN2O4/c1-3-28-18-7-4-13(21)8-12(18)9-15-11(2)23-24(19(15)25)14-5-6-17(22)16(10-14)20(26)27/h4-10H,3H2,1-2H3,(H,26,27)/b15-9- |
| InChIKey | UPNYRXSDUDEVPB-DHDCSXOGSA-N |
| XLogP | 5.01 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|