C22H20Br2N2O5 — CID 19655947
4-[(4Z)-4-[(2,3-dibromo-4,5-diethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 19655947) has the molecular formula C22H20Br2N2O5 and a molecular weight of 552.22 g/mol. Its IUPAC name is 4-[(4Z)-4-[(2,3-dibromo-4,5-diethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4Z)-4-[(2,3-dibromo-4,5-diethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 19655947 |
| Molecular Formula | C22H20Br2N2O5 |
| Molecular Weight | 552.22 g/mol |
| Exact Mass | 549.97 |
| IUPAC Name | 4-[(4Z)-4-[(2,3-dibromo-4,5-diethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3ccc(C(=O)O)cc3)N=C2C)c(Br)c(Br)c1OCC |
| InChI | InChI=1S/C22H20Br2N2O5/c1-4-30-17-11-14(18(23)19(24)20(17)31-5-2)10-16-12(3)25-26(21(16)27)15-8-6-13(7-9-15)22(28)29/h6-11H,4-5H2,1-3H3,(H,28,29)/b16-10- |
| InChIKey | MYEMJTLJXLYYHF-YBEGLDIGSA-N |
| XLogP | 5.51 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.22 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|