C21H21IN2O3 — CID 4095018
4-[(3,4-diethoxy-5-iodophenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 4095018) has the molecular formula C21H21IN2O3 and a molecular weight of 476.31 g/mol. Its IUPAC name is 4-[(3,4-diethoxy-5-iodophenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(3,4-diethoxy-5-iodophenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4095018 |
| Molecular Formula | C21H21IN2O3 |
| Molecular Weight | 476.31 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 4-[(3,4-diethoxy-5-iodophenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CCOc1cc(C=C2C(=O)N(c3ccccc3)N=C2C)cc(I)c1OCC |
| InChI | InChI=1S/C21H21IN2O3/c1-4-26-19-13-15(12-18(22)20(19)27-5-2)11-17-14(3)23-24(21(17)25)16-9-7-6-8-10-16/h6-13H,4-5H2,1-3H3 |
| InChIKey | YIEFYSQOXAILGK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|