C29H29BrN2O4 — CID 3948330
4-[[3-bromo-4-[2-(3,5-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 3948330) has the molecular formula C29H29BrN2O4 and a molecular weight of 549.47 g/mol. Its IUPAC name is 4-[[3-bromo-4-[2-(3,5-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-bromo-4-[2-(3,5-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 3948330 |
| Molecular Formula | C29H29BrN2O4 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 4-[[3-bromo-4-[2-(3,5-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CCOc1cc(C=C2C(=O)N(c3ccccc3)N=C2C)cc(Br)c1OCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C29H29BrN2O4/c1-5-34-27-18-22(16-25-21(4)31-32(29(25)33)23-9-7-6-8-10-23)17-26(30)28(27)36-12-11-35-24-14-19(2)13-20(3)15-24/h6-10,13-18H,5,11-12H2,1-4H3 |
| InChIKey | AWUHWLINIXVHIN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|