C31H34N2O5 — CID 6254568
(4E)-4-[[4-[2-[2-(3,4-dimethylphenoxy)ethoxy]ethoxy]-3-ethoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 6254568) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is (4E)-4-[[4-[2-[2-(3,4-dimethylphenoxy)ethoxy]ethoxy]-3-ethoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | (4E)-4-[[4-[2-[2-(3,4-dimethylphenoxy)ethoxy]ethoxy]-3-ethoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 6254568 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | (4E)-4-[[4-[2-[2-(3,4-dimethylphenoxy)ethoxy]ethoxy]-3-ethoxyphenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3ccccc3)N=C2C)ccc1OCCOCCOc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C31H34N2O5/c1-5-36-30-21-25(20-28-24(4)32-33(31(28)34)26-9-7-6-8-10-26)12-14-29(30)38-18-16-35-15-17-37-27-13-11-22(2)23(3)19-27/h6-14,19-21H,5,15-18H2,1-4H3/b28-20+ |
| InChIKey | GLILQVRMEGZSCT-VFCFBJKWSA-N |
| XLogP | 5.98 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|