C21H21BrN2O3 — CID 21214070
(4E)-2-(3-bromophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-5-methylpyrazol-3-one (PubChem CID 21214070) has the molecular formula C21H21BrN2O3 and a molecular weight of 429.31 g/mol. Its IUPAC name is (4E)-2-(3-bromophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4E)-2-(3-bromophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 21214070 |
| Molecular Formula | C21H21BrN2O3 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (4E)-2-(3-bromophenyl)-4-[(3,4-diethoxyphenyl)methylidene]-5-methylpyrazol-3-one |
| SMILES | CCOc1ccc(/C=C2/C(=O)N(c3cccc(Br)c3)N=C2C)cc1OCC |
| InChI | InChI=1S/C21H21BrN2O3/c1-4-26-19-10-9-15(12-20(19)27-5-2)11-18-14(3)23-24(21(18)25)17-8-6-7-16(22)13-17/h6-13H,4-5H2,1-3H3/b18-11+ |
| InChIKey | KORFLDCOTDAGNN-WOJGMQOQSA-N |
| XLogP | 5.05 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|