C20H18BrClN2O3 — CID 1222792
(4E)-2-(3-bromophenyl)-4-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylidene]-5-methylpyrazol-3-one (PubChem CID 1222792) has the molecular formula C20H18BrClN2O3 and a molecular weight of 449.73 g/mol. Its IUPAC name is (4E)-2-(3-bromophenyl)-4-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4E)-2-(3-bromophenyl)-4-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 1222792 |
| Molecular Formula | C20H18BrClN2O3 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | (4E)-2-(3-bromophenyl)-4-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylidene]-5-methylpyrazol-3-one |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3cccc(Br)c3)N=C2C)cc(Cl)c1OC |
| InChI | InChI=1S/C20H18BrClN2O3/c1-4-27-18-10-13(9-17(22)19(18)26-3)8-16-12(2)23-24(20(16)25)15-7-5-6-14(21)11-15/h5-11H,4H2,1-3H3/b16-8+ |
| InChIKey | GAFOBHQAGJPDKD-LZYBPNLTSA-N |
| XLogP | 5.32 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|