C20H18Cl2N2O4 — CID 1021417
2-(3,4-dichlorophenyl)-5-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazol-3-one (PubChem CID 1021417) has the molecular formula C20H18Cl2N2O4 and a molecular weight of 421.28 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazol-3-one.
| Compound Name | 2-(3,4-dichlorophenyl)-5-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 1021417 |
| Molecular Formula | C20H18Cl2N2O4 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-5-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrazol-3-one |
| SMILES | COc1cc(C=C2C(=O)N(c3ccc(Cl)c(Cl)c3)N=C2C)cc(OC)c1OC |
| InChI | InChI=1S/C20H18Cl2N2O4/c1-11-14(7-12-8-17(26-2)19(28-4)18(9-12)27-3)20(25)24(23-11)13-5-6-15(21)16(22)10-13/h5-10H,1-4H3 |
| InChIKey | PWBFXJYOWDQSCE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|