C19H14ClN3O7 — CID 135414141
2-chloro-5-[4-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 135414141) has the molecular formula C19H14ClN3O7 and a molecular weight of 431.79 g/mol. Its IUPAC name is 2-chloro-5-[4-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[4-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 135414141 |
| Molecular Formula | C19H14ClN3O7 |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-chloro-5-[4-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | COc1cc(C=C2C(=O)N(c3ccc(Cl)c(C(=O)O)c3)N=C2C)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H14ClN3O7/c1-9-12(5-10-6-15(23(28)29)17(24)16(7-10)30-2)18(25)22(21-9)11-3-4-14(20)13(8-11)19(26)27/h3-8,24H,1-2H3,(H,26,27) |
| InChIKey | OYSVWFBEXPCQGO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|