C18H13Cl2N3O4 — CID 6113088
(4Z)-2-(3,4-dichlorophenyl)-4-[(4-methoxy-3-nitrophenyl)methylidene]-5-methylpyrazol-3-one (PubChem CID 6113088) has the molecular formula C18H13Cl2N3O4 and a molecular weight of 406.23 g/mol. Its IUPAC name is (4Z)-2-(3,4-dichlorophenyl)-4-[(4-methoxy-3-nitrophenyl)methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4Z)-2-(3,4-dichlorophenyl)-4-[(4-methoxy-3-nitrophenyl)methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 6113088 |
| Molecular Formula | C18H13Cl2N3O4 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | (4Z)-2-(3,4-dichlorophenyl)-4-[(4-methoxy-3-nitrophenyl)methylidene]-5-methylpyrazol-3-one |
| SMILES | COc1ccc(/C=C2\C(=O)N(c3ccc(Cl)c(Cl)c3)N=C2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13Cl2N3O4/c1-10-13(7-11-3-6-17(27-2)16(8-11)23(25)26)18(24)22(21-10)12-4-5-14(19)15(20)9-12/h3-9H,1-2H3/b13-7- |
| InChIKey | FZFHDGUOCISJBQ-QPEQYQDCSA-N |
| XLogP | 4.72 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|