C19H17N3O5 — CID 2829385
4-[(3,4-dimethoxyphenyl)methylidene]-5-methyl-2-(4-nitrophenyl)pyrazol-3-one (PubChem CID 2829385) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methylidene]-5-methyl-2-(4-nitrophenyl)pyrazol-3-one.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methylidene]-5-methyl-2-(4-nitrophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 2829385 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methylidene]-5-methyl-2-(4-nitrophenyl)pyrazol-3-one |
| SMILES | COc1ccc(C=C2C(=O)N(c3ccc([N+](=O)[O-])cc3)N=C2C)cc1OC |
| InChI | InChI=1S/C19H17N3O5/c1-12-16(10-13-4-9-17(26-2)18(11-13)27-3)19(23)21(20-12)14-5-7-15(8-6-14)22(24)25/h4-11H,1-3H3 |
| InChIKey | ZARFTDPIBRPCHK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|