C22H22N4O6 — CID 2848934
4-[(3,4-dimethoxyphenyl)methylidene]-5-morpholin-4-yl-2-(4-nitrophenyl)pyrazol-3-one (PubChem CID 2848934) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methylidene]-5-morpholin-4-yl-2-(4-nitrophenyl)pyrazol-3-one.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methylidene]-5-morpholin-4-yl-2-(4-nitrophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 2848934 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methylidene]-5-morpholin-4-yl-2-(4-nitrophenyl)pyrazol-3-one |
| SMILES | COc1ccc(C=C2C(=O)N(c3ccc([N+](=O)[O-])cc3)N=C2N2CCOCC2)cc1OC |
| InChI | InChI=1S/C22H22N4O6/c1-30-19-8-3-15(14-20(19)31-2)13-18-21(24-9-11-32-12-10-24)23-25(22(18)27)16-4-6-17(7-5-16)26(28)29/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | CXWYWFNVHDXVSL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|