C22H15Cl2N3O5 — CID 4259221
2-(3,4-dichlorophenyl)-4-[[5-(4-methoxy-3-nitrophenyl)furan-2-yl]methylidene]-5-methylpyrazol-3-one (PubChem CID 4259221) has the molecular formula C22H15Cl2N3O5 and a molecular weight of 472.28 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-[[5-(4-methoxy-3-nitrophenyl)furan-2-yl]methylidene]-5-methylpyrazol-3-one.
| Compound Name | 2-(3,4-dichlorophenyl)-4-[[5-(4-methoxy-3-nitrophenyl)furan-2-yl]methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 4259221 |
| Molecular Formula | C22H15Cl2N3O5 |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-[[5-(4-methoxy-3-nitrophenyl)furan-2-yl]methylidene]-5-methylpyrazol-3-one |
| SMILES | COc1ccc(-c2ccc(C=C3C(=O)N(c4ccc(Cl)c(Cl)c4)N=C3C)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H15Cl2N3O5/c1-12-16(22(28)26(25-12)14-4-6-17(23)18(24)10-14)11-15-5-8-20(32-15)13-3-7-21(31-2)19(9-13)27(29)30/h3-11H,1-2H3 |
| InChIKey | SSEFXZRGYFCQLQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 98.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|