C19H15Cl2N3O5 — CID 1342801
(4E)-2-(3,5-dichlorophenyl)-4-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-5-methylpyrazol-3-one (PubChem CID 1342801) has the molecular formula C19H15Cl2N3O5 and a molecular weight of 436.25 g/mol. Its IUPAC name is (4E)-2-(3,5-dichlorophenyl)-4-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4E)-2-(3,5-dichlorophenyl)-4-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 1342801 |
| Molecular Formula | C19H15Cl2N3O5 |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | (4E)-2-(3,5-dichlorophenyl)-4-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-5-methylpyrazol-3-one |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3cc(Cl)cc(Cl)c3)N=C2C)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H15Cl2N3O5/c1-3-29-17-6-11(5-16(18(17)25)24(27)28)4-15-10(2)22-23(19(15)26)14-8-12(20)7-13(21)9-14/h4-9,25H,3H2,1-2H3/b15-4+ |
| InChIKey | RFKVAGJLPHVGKQ-SYZQJQIISA-N |
| XLogP | 4.81 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|