C20H13ClN2O6S — CID 5290264
2-chloro-5-[(4E)-4-[(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 5290264) has the molecular formula C20H13ClN2O6S and a molecular weight of 444.85 g/mol. Its IUPAC name is 2-chloro-5-[(4E)-4-[(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[(4E)-4-[(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 5290264 |
| Molecular Formula | C20H13ClN2O6S |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 2-chloro-5-[(4E)-4-[(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | COc1cc(/C=C2/C(=O)N(c3ccc(Cl)c(C(=O)O)c3)N=C2C)cc2sc(=O)oc12 |
| InChI | InChI=1S/C20H13ClN2O6S/c1-9-12(5-10-6-15(28-2)17-16(7-10)30-20(27)29-17)18(24)23(22-9)11-3-4-14(21)13(8-11)19(25)26/h3-8H,1-2H3,(H,25,26)/b12-5+ |
| InChIKey | CWDOAYXEHRQADW-LFYBBSHMSA-N |
| XLogP | 4.02 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'thio_carbonate_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|