C18H12ClIN2O3 — CID 50886767
2-chloro-5-[(4Z)-4-[(3-iodophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 50886767) has the molecular formula C18H12ClIN2O3 and a molecular weight of 466.66 g/mol. Its IUPAC name is 2-chloro-5-[(4Z)-4-[(3-iodophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[(4Z)-4-[(3-iodophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50886767 |
| Molecular Formula | C18H12ClIN2O3 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 465.96 |
| IUPAC Name | 2-chloro-5-[(4Z)-4-[(3-iodophenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CC1=NN(c2ccc(Cl)c(C(=O)O)c2)C(=O)/C1=C\c1cccc(I)c1 |
| InChI | InChI=1S/C18H12ClIN2O3/c1-10-14(8-11-3-2-4-12(20)7-11)17(23)22(21-10)13-5-6-16(19)15(9-13)18(24)25/h2-9H,1H3,(H,24,25)/b14-8- |
| InChIKey | HOFGKWRFWQAZJL-ZSOIEALJSA-N |
| XLogP | 4.45 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|