C20H15ClN2O3 — CID 97465873
2-chloro-5-[(4Z)-3-methyl-5-oxo-4-[(Z)-3-phenylprop-2-enylidene]pyrazol-1-yl]benzoic acid (PubChem CID 97465873) has the molecular formula C20H15ClN2O3 and a molecular weight of 366.80 g/mol. Its IUPAC name is 2-chloro-5-[(4Z)-3-methyl-5-oxo-4-[(Z)-3-phenylprop-2-enylidene]pyrazol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[(4Z)-3-methyl-5-oxo-4-[(Z)-3-phenylprop-2-enylidene]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 97465873 |
| Molecular Formula | C20H15ClN2O3 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-chloro-5-[(4Z)-3-methyl-5-oxo-4-[(Z)-3-phenylprop-2-enylidene]pyrazol-1-yl]benzoic acid |
| SMILES | CC1=NN(c2ccc(Cl)c(C(=O)O)c2)C(=O)/C1=C\C=C/c1ccccc1 |
| InChI | InChI=1S/C20H15ClN2O3/c1-13-16(9-5-8-14-6-3-2-4-7-14)19(24)23(22-13)15-10-11-18(21)17(12-15)20(25)26/h2-12H,1H3,(H,25,26)/b8-5-,16-9- |
| InChIKey | JQXFJEMPUVAMAM-VDNNZNEESA-N |
| XLogP | 4.40 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|