C22H20N2O3 — CID 71833163
ethyl 4-(4-cinnamylidene-3-methyl-5-oxopyrazol-1-yl)benzoate (PubChem CID 71833163) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl 4-(4-cinnamylidene-3-methyl-5-oxopyrazol-1-yl)benzoate.
| Compound Name | ethyl 4-(4-cinnamylidene-3-methyl-5-oxopyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 71833163 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | ethyl 4-(4-cinnamylidene-3-methyl-5-oxopyrazol-1-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2N=C(C)C(=CC=Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H20N2O3/c1-3-27-22(26)18-12-14-19(15-13-18)24-21(25)20(16(2)23-24)11-7-10-17-8-5-4-6-9-17/h4-15H,3H2,1-2H3 |
| InChIKey | JNFJKAMISMQFKD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|