C24H20N4O5 — CID 5498165
ethyl 4-[(4Z)-3-methyl-4-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-5-oxopyrazol-1-yl]benzoate (PubChem CID 5498165) has the molecular formula C24H20N4O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is ethyl 4-[(4Z)-3-methyl-4-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-5-oxopyrazol-1-yl]benzoate.
| Compound Name | ethyl 4-[(4Z)-3-methyl-4-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-5-oxopyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 5498165 |
| Molecular Formula | C24H20N4O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | ethyl 4-[(4Z)-3-methyl-4-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]-5-oxopyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2N=C(C)/C(=C/c3cccn3-c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H20N4O5/c1-3-33-24(30)17-6-8-19(9-7-17)27-23(29)22(16(2)25-27)15-21-5-4-14-26(21)18-10-12-20(13-11-18)28(31)32/h4-15H,3H2,1-2H3/b22-15- |
| InChIKey | YKAKKMJHCJQYME-JCMHNJIXSA-N |
| XLogP | 4.37 |
| TPSA | 107.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|