C26H20ClN3O6 — CID 6154169
[2-ethoxy-4-[(E)-[3-methyl-1-(4-nitrophenyl)-5-oxopyrazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 6154169) has the molecular formula C26H20ClN3O6 and a molecular weight of 505.91 g/mol. Its IUPAC name is [2-ethoxy-4-[(E)-[3-methyl-1-(4-nitrophenyl)-5-oxopyrazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [2-ethoxy-4-[(E)-[3-methyl-1-(4-nitrophenyl)-5-oxopyrazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6154169 |
| Molecular Formula | C26H20ClN3O6 |
| Molecular Weight | 505.91 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | [2-ethoxy-4-[(E)-[3-methyl-1-(4-nitrophenyl)-5-oxopyrazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3ccc([N+](=O)[O-])cc3)N=C2C)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C26H20ClN3O6/c1-3-35-24-15-17(8-13-23(24)36-26(32)20-6-4-5-7-22(20)27)14-21-16(2)28-29(25(21)31)18-9-11-19(12-10-18)30(33)34/h4-15H,3H2,1-2H3/b21-14+ |
| InChIKey | OFADVPRZCQDOSG-KGENOOAVSA-N |
| XLogP | 5.67 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.91 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|