C24H22N4O5S — CID 6266416
ethyl 4-[(4Z)-3-methyl-5-oxo-4-[[1-(4-sulfamoylphenyl)pyrrol-2-yl]methylidene]pyrazol-1-yl]benzoate (PubChem CID 6266416) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is ethyl 4-[(4Z)-3-methyl-5-oxo-4-[[1-(4-sulfamoylphenyl)pyrrol-2-yl]methylidene]pyrazol-1-yl]benzoate.
| Compound Name | ethyl 4-[(4Z)-3-methyl-5-oxo-4-[[1-(4-sulfamoylphenyl)pyrrol-2-yl]methylidene]pyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 6266416 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | ethyl 4-[(4Z)-3-methyl-5-oxo-4-[[1-(4-sulfamoylphenyl)pyrrol-2-yl]methylidene]pyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2N=C(C)/C(=C/c3cccn3-c3ccc(S(N)(=O)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c1-3-33-24(30)17-6-8-19(9-7-17)28-23(29)22(16(2)26-28)15-20-5-4-14-27(20)18-10-12-21(13-11-18)34(25,31)32/h4-15H,3H2,1-2H3,(H2,25,31,32)/b22-15- |
| InChIKey | SHGKVQFZXXJJKW-JCMHNJIXSA-N |
| XLogP | 3.11 |
| TPSA | 124.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|