C28H27N3O7S — CID 50885607
methyl 4-[[2-ethoxy-4-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 50885607) has the molecular formula C28H27N3O7S and a molecular weight of 549.61 g/mol. Its IUPAC name is methyl 4-[[2-ethoxy-4-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[2-ethoxy-4-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 50885607 |
| Molecular Formula | C28H27N3O7S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | methyl 4-[[2-ethoxy-4-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3ccc(S(N)(=O)=O)cc3)N=C2C)ccc1OCc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C28H27N3O7S/c1-4-37-26-16-20(7-14-25(26)38-17-19-5-8-21(9-6-19)28(33)36-3)15-24-18(2)30-31(27(24)32)22-10-12-23(13-11-22)39(29,34)35/h5-16H,4,17H2,1-3H3,(H2,29,34,35)/b24-15- |
| InChIKey | VMRLZCJNLIPNMQ-IWIPYMOSSA-N |
| XLogP | 3.90 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|