C22H19ClN4O3S — CID 22307323
4-[2-[(E)-[1-(3-chloro-4-methylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]pyrrol-1-yl]benzenesulfonamide (PubChem CID 22307323) has the molecular formula C22H19ClN4O3S and a molecular weight of 454.94 g/mol. Its IUPAC name is 4-[2-[(E)-[1-(3-chloro-4-methylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]pyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-[(E)-[1-(3-chloro-4-methylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]pyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22307323 |
| Molecular Formula | C22H19ClN4O3S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-[2-[(E)-[1-(3-chloro-4-methylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]pyrrol-1-yl]benzenesulfonamide |
| SMILES | CC1=NN(c2ccc(C)c(Cl)c2)C(=O)/C1=C/c1cccn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H19ClN4O3S/c1-14-5-6-18(13-21(14)23)27-22(28)20(15(2)25-27)12-17-4-3-11-26(17)16-7-9-19(10-8-16)31(24,29)30/h3-13H,1-2H3,(H2,24,29,30)/b20-12+ |
| InChIKey | XBRCNIRJKKWSKB-UDWIEESQSA-N |
| XLogP | 3.89 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|