C20H15F3N2O — CID 5441504
(4E)-5-methyl-4-[(E)-3-phenylprop-2-enylidene]-2-[3-(trifluoromethyl)phenyl]pyrazol-3-one (PubChem CID 5441504) has the molecular formula C20H15F3N2O and a molecular weight of 356.35 g/mol. Its IUPAC name is (4E)-5-methyl-4-[(E)-3-phenylprop-2-enylidene]-2-[3-(trifluoromethyl)phenyl]pyrazol-3-one.
| Compound Name | (4E)-5-methyl-4-[(E)-3-phenylprop-2-enylidene]-2-[3-(trifluoromethyl)phenyl]pyrazol-3-one |
|---|---|
| PubChem CID | 5441504 |
| Molecular Formula | C20H15F3N2O |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (4E)-5-methyl-4-[(E)-3-phenylprop-2-enylidene]-2-[3-(trifluoromethyl)phenyl]pyrazol-3-one |
| SMILES | CC1=NN(c2cccc(C(F)(F)F)c2)C(=O)/C1=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H15F3N2O/c1-14-18(12-5-9-15-7-3-2-4-8-15)19(26)25(24-14)17-11-6-10-16(13-17)20(21,22)23/h2-13H,1H3/b9-5+,18-12+ |
| InChIKey | YESRHGAJJNNSLQ-ASQNEQQHSA-N |
| XLogP | 5.07 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|