C21H22N4O4S — CID 18339059
amino 4-[(4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonate (PubChem CID 18339059) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is amino 4-[(4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonate.
| Compound Name | amino 4-[(4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonate |
|---|---|
| PubChem CID | 18339059 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | amino 4-[(4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonate |
| SMILES | CC1=NN(c2ccc(S(=O)(=O)ON)cc2)C(=O)/C1=C\C=C\c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H22N4O4S/c1-15-20(6-4-5-16-7-9-17(10-8-16)24(2)3)21(26)25(23-15)18-11-13-19(14-12-18)30(27,28)29-22/h4-14H,22H2,1-3H3/b5-4+,20-6- |
| InChIKey | TXDNKCSLAGGUPN-ZZLIIEFLSA-N |
| XLogP | 2.69 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|