C19H18N3NaO4S — CID 20700724
sodium (4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-methyl-2-(4-oxidoperoxysulfanylphenyl)pyrazol-3-one (PubChem CID 20700724) has the molecular formula C19H18N3NaO4S and a molecular weight of 407.43 g/mol. Its IUPAC name is sodium (4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-methyl-2-(4-oxidoperoxysulfanylphenyl)pyrazol-3-one.
| Compound Name | sodium (4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-methyl-2-(4-oxidoperoxysulfanylphenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 20700724 |
| Molecular Formula | C19H18N3NaO4S |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | sodium (4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-methyl-2-(4-oxidoperoxysulfanylphenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(SOO[O-])cc2)C(=O)/C1=C\c1ccc(N(C)C)cc1.[Na+] |
| InChI | InChI=1S/C19H19N3O4S.Na/c1-13-18(12-14-4-6-15(7-5-14)21(2)3)19(23)22(20-13)16-8-10-17(11-9-16)27-26-25-24;/h4-12,24H,1-3H3;/q;+1/p-1/b18-12-; |
| InChIKey | FGRVHKRGEVKJEF-UWRQUICRSA-M |
| XLogP | -0.21 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|