C19H17Cl2N3O — CID 1102442
2-(2,5-dichlorophenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-methylpyrazol-3-one (PubChem CID 1102442) has the molecular formula C19H17Cl2N3O and a molecular weight of 374.27 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-methylpyrazol-3-one.
| Compound Name | 2-(2,5-dichlorophenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 1102442 |
| Molecular Formula | C19H17Cl2N3O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2cc(Cl)ccc2Cl)C(=O)C1=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H17Cl2N3O/c1-12-16(10-13-4-7-15(8-5-13)23(2)3)19(25)24(22-12)18-11-14(20)6-9-17(18)21/h4-11H,1-3H3 |
| InChIKey | DVNDQUVSWMTEFV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|