C20H19Cl2N3O — CID 21214099
(4E)-2-(3,4-dichlorophenyl)-4-[[4-[ethyl(methyl)amino]phenyl]methylidene]-5-methylpyrazol-3-one (PubChem CID 21214099) has the molecular formula C20H19Cl2N3O and a molecular weight of 388.30 g/mol. Its IUPAC name is (4E)-2-(3,4-dichlorophenyl)-4-[[4-[ethyl(methyl)amino]phenyl]methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4E)-2-(3,4-dichlorophenyl)-4-[[4-[ethyl(methyl)amino]phenyl]methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 21214099 |
| Molecular Formula | C20H19Cl2N3O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (4E)-2-(3,4-dichlorophenyl)-4-[[4-[ethyl(methyl)amino]phenyl]methylidene]-5-methylpyrazol-3-one |
| SMILES | CCN(C)c1ccc(/C=C2/C(=O)N(c3ccc(Cl)c(Cl)c3)N=C2C)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O/c1-4-24(3)15-7-5-14(6-8-15)11-17-13(2)23-25(20(17)26)16-9-10-18(21)19(22)12-16/h5-12H,4H2,1-3H3/b17-11+ |
| InChIKey | XLJVTHHTHYOJEP-GZTJUZNOSA-N |
| XLogP | 5.26 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|