C21H20ClN3O3 — CID 1219874
2-chloro-5-[(4E)-4-[[4-[ethyl(methyl)amino]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 1219874) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is 2-chloro-5-[(4E)-4-[[4-[ethyl(methyl)amino]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[(4E)-4-[[4-[ethyl(methyl)amino]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 1219874 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-chloro-5-[(4E)-4-[[4-[ethyl(methyl)amino]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CCN(C)c1ccc(/C=C2/C(=O)N(c3ccc(Cl)c(C(=O)O)c3)N=C2C)cc1 |
| InChI | InChI=1S/C21H20ClN3O3/c1-4-24(3)15-7-5-14(6-8-15)11-17-13(2)23-25(20(17)26)16-9-10-19(22)18(12-16)21(27)28/h5-12H,4H2,1-3H3,(H,27,28)/b17-11+ |
| InChIKey | XGSOGDYXRKTESF-GZTJUZNOSA-N |
| XLogP | 4.30 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|