C21H18N3NaO6S — CID 101307897
sodium (4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylate (PubChem CID 101307897) has the molecular formula C21H18N3NaO6S and a molecular weight of 463.45 g/mol. Its IUPAC name is sodium (4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylate.
| Compound Name | sodium (4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 101307897 |
| Molecular Formula | C21H18N3NaO6S |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | sodium (4Z)-4-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-5-oxo-1-(4-sulfophenyl)pyrazole-3-carboxylate |
| SMILES | CN(C)c1ccc(/C=C/C=C2\C(=O)N(c3ccc(S(=O)(=O)O)cc3)N=C2C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C21H19N3O6S.Na/c1-23(2)15-8-6-14(7-9-15)4-3-5-18-19(21(26)27)22-24(20(18)25)16-10-12-17(13-11-16)31(28,29)30;/h3-13H,1-2H3,(H,26,27)(H,28,29,30);/q;+1/p-1/b4-3+,18-5-; |
| InChIKey | QVPBHVXMAPJUMA-PQXOWKIQSA-M |
| XLogP | -1.90 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|