C30H29N3O6 — CID 71833981
ethyl 4-[4-[[2-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate (PubChem CID 71833981) has the molecular formula C30H29N3O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is ethyl 4-[4-[[2-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[[2-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 71833981 |
| Molecular Formula | C30H29N3O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | ethyl 4-[4-[[2-[2-(4-ethoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2N=C(C)C(=Cc3ccccc3OCC(=O)Nc3ccc(OCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H29N3O6/c1-4-37-25-16-12-23(13-17-25)31-28(34)19-39-27-9-7-6-8-22(27)18-26-20(3)32-33(29(26)35)24-14-10-21(11-15-24)30(36)38-5-2/h6-18H,4-5,19H2,1-3H3,(H,31,34) |
| InChIKey | UKBIKFVQOILKJZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|