C28H25N3O5S — CID 16633462
ethyl 4-[(5Z)-2-imino-5-[[2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-3-yl]benzoate (PubChem CID 16633462) has the molecular formula C28H25N3O5S and a molecular weight of 515.59 g/mol. Its IUPAC name is ethyl 4-[(5Z)-2-imino-5-[[2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | ethyl 4-[(5Z)-2-imino-5-[[2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 16633462 |
| Molecular Formula | C28H25N3O5S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | ethyl 4-[(5Z)-2-imino-5-[[2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-3-yl]benzoate |
| SMILES | [H]/N=C1\S/C(=C\c2ccccc2OCC(=O)Nc2ccc(C)cc2)C(=O)N1c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C28H25N3O5S/c1-3-35-27(34)19-10-14-22(15-11-19)31-26(33)24(37-28(31)29)16-20-6-4-5-7-23(20)36-17-25(32)30-21-12-8-18(2)9-13-21/h4-16,29H,3,17H2,1-2H3,(H,30,32)/b24-16-,29-28- |
| InChIKey | LILQMJCTWBACMF-UVTSATJFSA-N |
| XLogP | 5.24 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|