C21H15FN4O3S2 — CID 16633678
N-(4-fluorophenyl)-2-[2-[(Z)-[2-imino-4-oxo-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 16633678) has the molecular formula C21H15FN4O3S2 and a molecular weight of 454.51 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-[(Z)-[2-imino-4-oxo-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-[(Z)-[2-imino-4-oxo-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 16633678 |
| Molecular Formula | C21H15FN4O3S2 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-[(Z)-[2-imino-4-oxo-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | [H]/N=C1\S/C(=C\c2ccccc2OCC(=O)Nc2ccc(F)cc2)C(=O)N1c1nccs1 |
| InChI | InChI=1S/C21H15FN4O3S2/c22-14-5-7-15(8-6-14)25-18(27)12-29-16-4-2-1-3-13(16)11-17-19(28)26(20(23)31-17)21-24-9-10-30-21/h1-11,23H,12H2,(H,25,27)/b17-11-,23-20- |
| InChIKey | QSPAVFNCIQPSPI-NKHYKUCGSA-N |
| XLogP | 4.36 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_D(8)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|