C24H16Cl2FN3O3S — CID 16633371
2-[4-chloro-2-[(Z)-[3-(4-fluorophenyl)-2-imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 16633371) has the molecular formula C24H16Cl2FN3O3S and a molecular weight of 516.38 g/mol. Its IUPAC name is 2-[4-chloro-2-[(Z)-[3-(4-fluorophenyl)-2-imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(Z)-[3-(4-fluorophenyl)-2-imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 16633371 |
| Molecular Formula | C24H16Cl2FN3O3S |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | 2-[4-chloro-2-[(Z)-[3-(4-fluorophenyl)-2-imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | [H]/N=C1\S/C(=C\c2cc(Cl)ccc2OCC(=O)Nc2ccc(Cl)cc2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H16Cl2FN3O3S/c25-15-1-6-18(7-2-15)29-22(31)13-33-20-10-3-16(26)11-14(20)12-21-23(32)30(24(28)34-21)19-8-4-17(27)5-9-19/h1-12,28H,13H2,(H,29,31)/b21-12-,28-24- |
| InChIKey | UIXXJHIZPLRNFL-ZEEHGSAPSA-N |
| XLogP | 6.21 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|