C24H17Cl2N3O3S — CID 16633143
2-[4-chloro-2-[(Z)-(2-imino-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 16633143) has the molecular formula C24H17Cl2N3O3S and a molecular weight of 498.39 g/mol. Its IUPAC name is 2-[4-chloro-2-[(Z)-(2-imino-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(Z)-(2-imino-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 16633143 |
| Molecular Formula | C24H17Cl2N3O3S |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | 2-[4-chloro-2-[(Z)-(2-imino-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | [H]/N=C1\S/C(=C\c2cc(Cl)ccc2OCC(=O)Nc2ccc(Cl)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H17Cl2N3O3S/c25-16-6-9-18(10-7-16)28-22(30)14-32-20-11-8-17(26)12-15(20)13-21-23(31)29(24(27)33-21)19-4-2-1-3-5-19/h1-13,27H,14H2,(H,28,30)/b21-13-,27-24- |
| InChIKey | VUQWVMQINRVAIU-BXHPTCRHSA-N |
| XLogP | 6.07 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|