C25H17F4N3O3S — CID 16633591
N-(4-fluorophenyl)-2-[2-[(Z)-[2-imino-4-oxo-3-[2-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 16633591) has the molecular formula C25H17F4N3O3S and a molecular weight of 515.49 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-[(Z)-[2-imino-4-oxo-3-[2-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-[(Z)-[2-imino-4-oxo-3-[2-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 16633591 |
| Molecular Formula | C25H17F4N3O3S |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-[(Z)-[2-imino-4-oxo-3-[2-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | [H]/N=C1\S/C(=C\c2ccccc2OCC(=O)Nc2ccc(F)cc2)C(=O)N1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H17F4N3O3S/c26-16-9-11-17(12-10-16)31-22(33)14-35-20-8-4-1-5-15(20)13-21-23(34)32(24(30)36-21)19-7-3-2-6-18(19)25(27,28)29/h1-13,30H,14H2,(H,31,33)/b21-13-,30-24- |
| InChIKey | BPWXMBLNIUPZTH-DARWHTCMSA-N |
| XLogP | 5.92 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|