C25H21ClN4O6S2 — CID 16633421
2-[4-chloro-2-[(Z)-[2-imino-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16633421) has the molecular formula C25H21ClN4O6S2 and a molecular weight of 573.05 g/mol. Its IUPAC name is 2-[4-chloro-2-[(Z)-[2-imino-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(Z)-[2-imino-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16633421 |
| Molecular Formula | C25H21ClN4O6S2 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 2-[4-chloro-2-[(Z)-[2-imino-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | [H]/N=C1\S/C(=C\c2cc(Cl)ccc2OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H21ClN4O6S2/c1-35-19-7-5-18(6-8-19)30-24(32)22(37-25(30)27)13-15-12-16(26)2-11-21(15)36-14-23(31)29-17-3-9-20(10-4-17)38(28,33)34/h2-13,27H,14H2,1H3,(H,29,31)(H2,28,33,34)/b22-13-,27-25- |
| InChIKey | PZYDMLFOCDOJCU-AVXIRIOFSA-N |
| XLogP | 4.07 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|