C23H20ClN3O9S3 — CID 16628927
2-[(5Z)-5-[[5-chloro-2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid (PubChem CID 16628927) has the molecular formula C23H20ClN3O9S3 and a molecular weight of 614.08 g/mol. Its IUPAC name is 2-[(5Z)-5-[[5-chloro-2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid.
| Compound Name | 2-[(5Z)-5-[[5-chloro-2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 16628927 |
| Molecular Formula | C23H20ClN3O9S3 |
| Molecular Weight | 614.08 g/mol |
| Exact Mass | 613.01 |
| IUPAC Name | 2-[(5Z)-5-[[5-chloro-2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2/C=C2\SC(=S)N(C(CCC(=O)O)C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C23H20ClN3O9S3/c24-13-1-7-17(36-11-19(28)26-14-2-4-15(5-3-14)39(25,34)35)12(9-13)10-18-21(31)27(23(37)38-18)16(22(32)33)6-8-20(29)30/h1-5,7,9-10,16H,6,8,11H2,(H,26,28)(H,29,30)(H,32,33)(H2,25,34,35)/b18-10- |
| InChIKey | JCLBCNKJJUJRTO-ZDLGFXPLSA-N |
| XLogP | 2.52 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.08 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|