C22H19BrN2O5S2 — CID 16628799
3-[(5Z)-5-[[5-bromo-2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 16628799) has the molecular formula C22H19BrN2O5S2 and a molecular weight of 535.44 g/mol. Its IUPAC name is 3-[(5Z)-5-[[5-bromo-2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[[5-bromo-2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 16628799 |
| Molecular Formula | C22H19BrN2O5S2 |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 533.99 |
| IUPAC Name | 3-[(5Z)-5-[[5-bromo-2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | Cc1ccc(NC(=O)COc2ccc(Br)cc2/C=C2\SC(=S)N(CCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C22H19BrN2O5S2/c1-13-2-5-16(6-3-13)24-19(26)12-30-17-7-4-15(23)10-14(17)11-18-21(29)25(22(31)32-18)9-8-20(27)28/h2-7,10-11H,8-9,12H2,1H3,(H,24,26)(H,27,28)/b18-11- |
| InChIKey | DQKSPAGXMGCTOQ-WQRHYEAKSA-N |
| XLogP | 4.45 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|