C24H22BrClN2O5S2 — CID 16628841
6-[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 16628841) has the molecular formula C24H22BrClN2O5S2 and a molecular weight of 597.94 g/mol. Its IUPAC name is 6-[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 16628841 |
| Molecular Formula | C24H22BrClN2O5S2 |
| Molecular Weight | 597.94 g/mol |
| Exact Mass | 595.98 |
| IUPAC Name | 6-[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)/C(=C/c2cc(Br)ccc2OCC(=O)Nc2ccc(Cl)cc2)SC1=S |
| InChI | InChI=1S/C24H22BrClN2O5S2/c25-16-5-10-19(33-14-21(29)27-18-8-6-17(26)7-9-18)15(12-16)13-20-23(32)28(24(34)35-20)11-3-1-2-4-22(30)31/h5-10,12-13H,1-4,11,14H2,(H,27,29)(H,30,31)/b20-13- |
| InChIKey | KILSBXDAPOKALC-MOSHPQCFSA-N |
| XLogP | 5.97 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.94 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|