C21H16BrCl2NO4S2 — CID 19199148
4-[(5E)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 19199148) has the molecular formula C21H16BrCl2NO4S2 and a molecular weight of 561.31 g/mol. Its IUPAC name is 4-[(5E)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5E)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 19199148 |
| Molecular Formula | C21H16BrCl2NO4S2 |
| Molecular Weight | 561.31 g/mol |
| Exact Mass | 558.91 |
| IUPAC Name | 4-[(5E)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)/C(=C\c2cc(Br)ccc2OCc2ccc(Cl)cc2Cl)SC1=S |
| InChI | InChI=1S/C21H16BrCl2NO4S2/c22-14-4-6-17(29-11-12-3-5-15(23)10-16(12)24)13(8-14)9-18-20(28)25(21(30)31-18)7-1-2-19(26)27/h3-6,8-10H,1-2,7,11H2,(H,26,27)/b18-9+ |
| InChIKey | MWJHGHPNKHXMIQ-GIJQJNRQSA-N |
| XLogP | 6.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.31 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|