C21H15Cl4N3O4S2 — CID 2855920
N'-[2-(2,4-dichlorophenoxy)acetyl]-3-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide (PubChem CID 2855920) has the molecular formula C21H15Cl4N3O4S2 and a molecular weight of 579.31 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenoxy)acetyl]-3-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide |
|---|---|
| PubChem CID | 2855920 |
| Molecular Formula | C21H15Cl4N3O4S2 |
| Molecular Weight | 579.31 g/mol |
| Exact Mass | 576.93 |
| IUPAC Name | N'-[2-(2,4-dichlorophenoxy)acetyl]-3-[5-[(2,4-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanehydrazide |
| SMILES | O=C(CCN1C(=O)C(=Cc2ccc(Cl)cc2Cl)SC1=S)NNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H15Cl4N3O4S2/c22-12-2-1-11(14(24)8-12)7-17-20(31)28(21(33)34-17)6-5-18(29)26-27-19(30)10-32-16-4-3-13(23)9-15(16)25/h1-4,7-9H,5-6,10H2,(H,26,29)(H,27,30) |
| InChIKey | JDUJNDUJAFNCOD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.31 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|