C19H14Cl2N2O2S2 — CID 1346348
N-(4-chlorophenyl)-3-[(5E)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 1346348) has the molecular formula C19H14Cl2N2O2S2 and a molecular weight of 437.37 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[(5E)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(4-chlorophenyl)-3-[(5E)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 1346348 |
| Molecular Formula | C19H14Cl2N2O2S2 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | N-(4-chlorophenyl)-3-[(5E)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | O=C(CCN1C(=O)/C(=C\c2ccccc2Cl)SC1=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O2S2/c20-13-5-7-14(8-6-13)22-17(24)9-10-23-18(25)16(27-19(23)26)11-12-3-1-2-4-15(12)21/h1-8,11H,9-10H2,(H,22,24)/b16-11+ |
| InChIKey | VKIVWMRTLXYVLM-LFIBNONCSA-N |
| XLogP | 5.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|