C20H14ClF3N2O2S2 — CID 1345350
3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 1345350) has the molecular formula C20H14ClF3N2O2S2 and a molecular weight of 470.93 g/mol. Its IUPAC name is 3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 1345350 |
| Molecular Formula | C20H14ClF3N2O2S2 |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | 3-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)/C(=C/c2ccccc2Cl)SC1=S)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H14ClF3N2O2S2/c21-14-7-3-1-5-12(14)11-16-18(28)26(19(29)30-16)10-9-17(27)25-15-8-4-2-6-13(15)20(22,23)24/h1-8,11H,9-10H2,(H,25,27)/b16-11- |
| InChIKey | JCXDPXFDNFSEFJ-WJDWOHSUSA-N |
| XLogP | 5.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|