C20H13Cl2F3N2O2S2 — CID 3721059
3-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 3721059) has the molecular formula C20H13Cl2F3N2O2S2 and a molecular weight of 505.37 g/mol. Its IUPAC name is 3-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 3721059 |
| Molecular Formula | C20H13Cl2F3N2O2S2 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 503.97 |
| IUPAC Name | 3-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)C(=Cc2ccccc2Cl)SC1=S)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13Cl2F3N2O2S2/c21-14-4-2-1-3-11(14)9-16-18(29)27(19(30)31-16)8-7-17(28)26-12-5-6-15(22)13(10-12)20(23,24)25/h1-6,9-10H,7-8H2,(H,26,28) |
| InChIKey | LNOQCTPUWWOPJI-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|