C21H18ClF3N2O2S3 — CID 4503079
N-[4-chloro-3-(trifluoromethyl)phenyl]-6-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide (PubChem CID 4503079) has the molecular formula C21H18ClF3N2O2S3 and a molecular weight of 519.04 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-6-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-6-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 4503079 |
| Molecular Formula | C21H18ClF3N2O2S3 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-6-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C(=Cc2cccs2)SC1=S)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18ClF3N2O2S3/c22-16-8-7-13(11-15(16)21(23,24)25)26-18(28)6-2-1-3-9-27-19(29)17(32-20(27)30)12-14-5-4-10-31-14/h4-5,7-8,10-12H,1-3,6,9H2,(H,26,28) |
| InChIKey | OMDXCXNABAHRFN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|