C22H24N2O2S3 — CID 4502692
N-(3,4-dimethylphenyl)-6-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide (PubChem CID 4502692) has the molecular formula C22H24N2O2S3 and a molecular weight of 444.65 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-6-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide.
| Compound Name | N-(3,4-dimethylphenyl)-6-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 4502692 |
| Molecular Formula | C22H24N2O2S3 |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-6-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide |
| SMILES | Cc1ccc(NC(=O)CCCCCN2C(=O)C(=Cc3cccs3)SC2=S)cc1C |
| InChI | InChI=1S/C22H24N2O2S3/c1-15-9-10-17(13-16(15)2)23-20(25)8-4-3-5-11-24-21(26)19(29-22(24)27)14-18-7-6-12-28-18/h6-7,9-10,12-14H,3-5,8,11H2,1-2H3,(H,23,25) |
| InChIKey | FKBBJWKFXANQHP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|