C22H16ClF3N2O4S2 — CID 4758614
4-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide (PubChem CID 4758614) has the molecular formula C22H16ClF3N2O4S2 and a molecular weight of 528.96 g/mol. Its IUPAC name is 4-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 4758614 |
| Molecular Formula | C22H16ClF3N2O4S2 |
| Molecular Weight | 528.96 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | 4-[5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide |
| SMILES | O=C(CCCN1C(=O)C(=Cc2ccc3c(c2)OCO3)SC1=S)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16ClF3N2O4S2/c23-15-5-4-13(10-14(15)22(24,25)26)27-19(29)2-1-7-28-20(30)18(34-21(28)33)9-12-3-6-16-17(8-12)32-11-31-16/h3-6,8-10H,1-2,7,11H2,(H,27,29) |
| InChIKey | BIUHTYCVPDZHHT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.96 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|